C19H20ClN5O3S2 — CID 3880126
N'-[2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 3880126) has the molecular formula C19H20ClN5O3S2 and a molecular weight of 465.99 g/mol. Its IUPAC name is N'-[2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 3880126 |
| Molecular Formula | C19H20ClN5O3S2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N'-[2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | COCCCn1c(SCC(=O)NNC(=O)c2cccs2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClN5O3S2/c1-28-10-3-9-25-17(13-5-7-14(20)8-6-13)22-24-19(25)30-12-16(26)21-23-18(27)15-4-2-11-29-15/h2,4-8,11H,3,9-10,12H2,1H3,(H,21,26)(H,23,27) |
| InChIKey | TWAVVRKJLOEJMK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|