C20H15ClN6O2S2 — CID 5300385
N'-[2-[[4-(2-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 5300385) has the molecular formula C20H15ClN6O2S2 and a molecular weight of 470.97 g/mol. Its IUPAC name is N'-[2-[[4-(2-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[[4-(2-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 5300385 |
| Molecular Formula | C20H15ClN6O2S2 |
| Molecular Weight | 470.97 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | N'-[2-[[4-(2-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccncc2)n1-c1ccccc1Cl)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C20H15ClN6O2S2/c21-14-4-1-2-5-15(14)27-18(13-7-9-22-10-8-13)24-26-20(27)31-12-17(28)23-25-19(29)16-6-3-11-30-16/h1-11H,12H2,(H,23,28)(H,25,29) |
| InChIKey | MBCMWACIVSCYFX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.97 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|