C19H15N5O3S2 — CID 3896842
N'-[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 3896842) has the molecular formula C19H15N5O3S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is N'-[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 3896842 |
| Molecular Formula | C19H15N5O3S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N'-[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C19H15N5O3S2/c25-16(20-22-18(26)15-9-5-11-28-15)12-29-19-23-21-17(14-8-4-10-27-14)24(19)13-6-2-1-3-7-13/h1-11H,12H2,(H,20,25)(H,22,26) |
| InChIKey | VTOOQMKXLLBVMC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|