C13H10N4O4S2 — CID 18074923
N'-[2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 18074923) has the molecular formula C13H10N4O4S2 and a molecular weight of 350.38 g/mol. Its IUPAC name is N'-[2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 18074923 |
| Molecular Formula | C13H10N4O4S2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | N'-[2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccco2)o1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H10N4O4S2/c18-10(14-15-11(19)9-4-2-6-22-9)7-23-13-17-16-12(21-13)8-3-1-5-20-8/h1-6H,7H2,(H,14,18)(H,15,19) |
| InChIKey | KBJKSVQHYZKEQD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|