C16H14N4O4S — CID 7816367
N'-[2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 7816367) has the molecular formula C16H14N4O4S and a molecular weight of 358.38 g/mol. Its IUPAC name is N'-[2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 7816367 |
| Molecular Formula | C16H14N4O4S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N'-[2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | Cc1ccc(-c2nnc(SCC(=O)NNC(=O)c3ccco3)o2)cc1 |
| InChI | InChI=1S/C16H14N4O4S/c1-10-4-6-11(7-5-10)15-19-20-16(24-15)25-9-13(21)17-18-14(22)12-3-2-8-23-12/h2-8H,9H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | SDGJMVFGWZUCDW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|