C15H18N4O4S — CID 7957428
N'-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 7957428) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is N'-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 7957428 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N'-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | O=C(CSc1nnc(C2CCCCC2)o1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C15H18N4O4S/c20-12(16-17-13(21)11-7-4-8-22-11)9-24-15-19-18-14(23-15)10-5-2-1-3-6-10/h4,7-8,10H,1-3,5-6,9H2,(H,16,20)(H,17,21) |
| InChIKey | HOZNXTPGTIRCBO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|