C19H22N4O5S — CID 7957374
(3S)-N'-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 7957374) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is (3S)-N'-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | (3S)-N'-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 7957374 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (3S)-N'-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(CSc1nnc(C2CCCCC2)o1)NNC(=O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C19H22N4O5S/c24-16(11-29-19-23-22-18(28-19)12-6-2-1-3-7-12)20-21-17(25)15-10-26-13-8-4-5-9-14(13)27-15/h4-5,8-9,12,15H,1-3,6-7,10-11H2,(H,20,24)(H,21,25)/t15-/m0/s1 |
| InChIKey | SSFAGOKWNSICKL-HNNXBMFYSA-N |
| XLogP | 2.20 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|