C18H17BrN2O4S — CID 2126886
(3S)-N'-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 2126886) has the molecular formula C18H17BrN2O4S and a molecular weight of 437.32 g/mol. Its IUPAC name is (3S)-N'-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | (3S)-N'-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 2126886 |
| Molecular Formula | C18H17BrN2O4S |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | (3S)-N'-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | Cc1cc(Br)ccc1SCC(=O)NNC(=O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C18H17BrN2O4S/c1-11-8-12(19)6-7-16(11)26-10-17(22)20-21-18(23)15-9-24-13-4-2-3-5-14(13)25-15/h2-8,15H,9-10H2,1H3,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | YGJNPLRTLVKHKS-HNNXBMFYSA-N |
| XLogP | 2.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|