C22H22N4O4S — CID 55359051
N'-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 55359051) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is N'-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | N'-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 55359051 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N'-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | Cc1cc(C)cc(-n2ccnc2SCC(=O)NNC(=O)C2COc3ccccc3O2)c1 |
| InChI | InChI=1S/C22H22N4O4S/c1-14-9-15(2)11-16(10-14)26-8-7-23-22(26)31-13-20(27)24-25-21(28)19-12-29-17-5-3-4-6-18(17)30-19/h3-11,19H,12-13H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | BVPFATDMJLFWKU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|