C16H13BrN2O4 — CID 55332469
N'-(3-bromobenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 55332469) has the molecular formula C16H13BrN2O4 and a molecular weight of 377.19 g/mol. Its IUPAC name is N'-(3-bromobenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | N'-(3-bromobenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 55332469 |
| Molecular Formula | C16H13BrN2O4 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | N'-(3-bromobenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1COc2ccccc2O1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H13BrN2O4/c17-11-5-3-4-10(8-11)15(20)18-19-16(21)14-9-22-12-6-1-2-7-13(12)23-14/h1-8,14H,9H2,(H,18,20)(H,19,21) |
| InChIKey | YXINNDVUZYCFEE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|