C16H14N4O6 — CID 24980654
N'-(4-amino-3-nitrobenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 24980654) has the molecular formula C16H14N4O6 and a molecular weight of 358.31 g/mol. Its IUPAC name is N'-(4-amino-3-nitrobenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | N'-(4-amino-3-nitrobenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 24980654 |
| Molecular Formula | C16H14N4O6 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N'-(4-amino-3-nitrobenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | C1C(OC2=CC=CC=C2O1)C(=O)NNC(=O)C3=CC(=C(C=C3)N)[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N4O6/c17-10-6-5-9(7-11(10)20(23)24)15(21)18-19-16(22)14-8-25-12-3-1-2-4-13(12)26-14/h1-7,14H,8,17H2,(H,18,21)(H,19,22) |
| InChIKey | YHJJTLAZMCFDEH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | 553 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|