C20H20N4O6 — CID 41012984
(3R)-N'-(3-nitro-4-pyrrolidin-1-ylbenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 41012984) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is (3R)-N'-(3-nitro-4-pyrrolidin-1-ylbenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | (3R)-N'-(3-nitro-4-pyrrolidin-1-ylbenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 41012984 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (3R)-N'-(3-nitro-4-pyrrolidin-1-ylbenzoyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@H]1COc2ccccc2O1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N4O6/c25-19(13-7-8-14(15(11-13)24(27)28)23-9-3-4-10-23)21-22-20(26)18-12-29-16-5-1-2-6-17(16)30-18/h1-2,5-8,11,18H,3-4,9-10,12H2,(H,21,25)(H,22,26)/t18-/m1/s1 |
| InChIKey | BBQMMFUKBIEFNP-GOSISDBHSA-N |
| XLogP | 1.80 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|