C20H18N4O5 — CID 17221370
2-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-5-nitrobenzonitrile (PubChem CID 17221370) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-5-nitrobenzonitrile.
| Compound Name | 2-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 17221370 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N1CCN(C(=O)C2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C20H18N4O5/c21-12-14-11-15(24(26)27)5-6-16(14)22-7-9-23(10-8-22)20(25)19-13-28-17-3-1-2-4-18(17)29-19/h1-6,11,19H,7-10,13H2 |
| InChIKey | DUZUTXPUCGTBEM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 108.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|