C22H16FN3O6S — CID 55477033
N'-[2-(2-fluorophenyl)sulfanyl-5-nitrobenzoyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 55477033) has the molecular formula C22H16FN3O6S and a molecular weight of 469.45 g/mol. Its IUPAC name is N'-[2-(2-fluorophenyl)sulfanyl-5-nitrobenzoyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | N'-[2-(2-fluorophenyl)sulfanyl-5-nitrobenzoyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 55477033 |
| Molecular Formula | C22H16FN3O6S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N'-[2-(2-fluorophenyl)sulfanyl-5-nitrobenzoyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1COc2ccccc2O1)c1cc([N+](=O)[O-])ccc1Sc1ccccc1F |
| InChI | InChI=1S/C22H16FN3O6S/c23-15-5-1-4-8-20(15)33-19-10-9-13(26(29)30)11-14(19)21(27)24-25-22(28)18-12-31-16-6-2-3-7-17(16)32-18/h1-11,18H,12H2,(H,24,27)(H,25,28) |
| InChIKey | CDODUOKDJBTPFK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|