C11H16N2O3S — CID 62590738
2-[(5-cycloheptyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid (PubChem CID 62590738) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-[(5-cycloheptyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(5-cycloheptyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 62590738 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-[(5-cycloheptyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(C2CCCCCC2)o1 |
| InChI | InChI=1S/C11H16N2O3S/c14-9(15)7-17-11-13-12-10(16-11)8-5-3-1-2-4-6-8/h8H,1-7H2,(H,14,15) |
| InChIKey | JGEUTWGKZHXCTN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |