C15H11ClN4O3S2 — CID 2082579
4-chloro-N'-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 2082579) has the molecular formula C15H11ClN4O3S2 and a molecular weight of 394.87 g/mol. Its IUPAC name is 4-chloro-N'-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 2082579 |
| Molecular Formula | C15H11ClN4O3S2 |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 4-chloro-N'-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1nnc(-c2cccs2)o1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClN4O3S2/c16-10-5-3-9(4-6-10)13(22)18-17-12(21)8-25-15-20-19-14(23-15)11-2-1-7-24-11/h1-7H,8H2,(H,17,21)(H,18,22) |
| InChIKey | XOLFBVGNVBEVFJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|