C15H15N3O2S4 — CID 8951232
N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 8951232) has the molecular formula C15H15N3O2S4 and a molecular weight of 397.57 g/mol. Its IUPAC name is N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 8951232 |
| Molecular Formula | C15H15N3O2S4 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccs2)o1)NCCSCc1cccs1 |
| InChI | InChI=1S/C15H15N3O2S4/c19-13(16-5-8-21-9-11-3-1-6-22-11)10-24-15-18-17-14(20-15)12-4-2-7-23-12/h1-4,6-7H,5,8-10H2,(H,16,19) |
| InChIKey | GBIMUAVVZRTEEP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|