C13H13ClN4O3S — CID 8707982
4-chloro-N'-[2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 8707982) has the molecular formula C13H13ClN4O3S and a molecular weight of 340.79 g/mol. Its IUPAC name is 4-chloro-N'-[2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8707982 |
| Molecular Formula | C13H13ClN4O3S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 4-chloro-N'-[2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | CCc1nnc(SCC(=O)NNC(=O)c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C13H13ClN4O3S/c1-2-11-16-18-13(21-11)22-7-10(19)15-17-12(20)8-3-5-9(14)6-4-8/h3-6H,2,7H2,1H3,(H,15,19)(H,17,20) |
| InChIKey | OUTXXFCMGQCMFX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|