C16H15N5O3S2 — CID 7810350
N'-[2-[[5-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 7810350) has the molecular formula C16H15N5O3S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N'-[2-[[5-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[[5-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7810350 |
| Molecular Formula | C16H15N5O3S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N'-[2-[[5-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | Cc1nc(Cc2nnc(SCC(=O)NNC(=O)c3ccccc3)o2)cs1 |
| InChI | InChI=1S/C16H15N5O3S2/c1-10-17-12(8-25-10)7-14-19-21-16(24-14)26-9-13(22)18-20-15(23)11-5-3-2-4-6-11/h2-6,8H,7,9H2,1H3,(H,18,22)(H,20,23) |
| InChIKey | RTVZGFPEZIAHMA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|