C12H14N6O2S — CID 7845119
N'-[2-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 7845119) has the molecular formula C12H14N6O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is N'-[2-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7845119 |
| Molecular Formula | C12H14N6O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N'-[2-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | Cc1nnc(SCC(=O)NNC(=O)c2ccccc2)n1N |
| InChI | InChI=1S/C12H14N6O2S/c1-8-14-17-12(18(8)13)21-7-10(19)15-16-11(20)9-5-3-2-4-6-9/h2-6H,7,13H2,1H3,(H,15,19)(H,16,20) |
| InChIKey | MISNXMMBJOMFQN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|