C21H21N5O2S — CID 1140105
N'-[2-[(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 1140105) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is N'-[2-[(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 1140105 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N'-[2-[(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | CC1(C)Cc2ccccc2-c2nnc(SCC(=O)NNC(=O)c3ccccc3)n21 |
| InChI | InChI=1S/C21H21N5O2S/c1-21(2)12-15-10-6-7-11-16(15)18-23-25-20(26(18)21)29-13-17(27)22-24-19(28)14-8-4-3-5-9-14/h3-11H,12-13H2,1-2H3,(H,22,27)(H,24,28) |
| InChIKey | IZLCFCQTVGRAMR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|