C18H19N5OS2 — CID 1140102
2-[(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)sulfanyl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 1140102) has the molecular formula C18H19N5OS2 and a molecular weight of 385.52 g/mol. Its IUPAC name is 2-[(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)sulfanyl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)sulfanyl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 1140102 |
| Molecular Formula | C18H19N5OS2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)sulfanyl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cnc(NC(=O)CSc2nnc3n2C(C)(C)Cc2ccccc2-3)s1 |
| InChI | InChI=1S/C18H19N5OS2/c1-11-9-19-16(26-11)20-14(24)10-25-17-22-21-15-13-7-5-4-6-12(13)8-18(2,3)23(15)17/h4-7,9H,8,10H2,1-3H3,(H,19,20,24) |
| InChIKey | STQJCVQCUDSAAJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |