C22H19N5O3S — CID 2087637
N'-[2-[[4-(furan-2-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 2087637) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is N'-[2-[[4-(furan-2-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[[4-(furan-2-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 2087637 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N'-[2-[[4-(furan-2-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1Cc1ccco1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19N5O3S/c28-19(23-25-21(29)17-10-5-2-6-11-17)15-31-22-26-24-20(16-8-3-1-4-9-16)27(22)14-18-12-7-13-30-18/h1-13H,14-15H2,(H,23,28)(H,25,29) |
| InChIKey | AURZMKBLEDWEPU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|