C22H26N6O3S — CID 46688700
N'-[2-[[4-(furan-2-ylmethyl)-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 46688700) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is N'-[2-[[4-(furan-2-ylmethyl)-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[[4-(furan-2-ylmethyl)-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 46688700 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N'-[2-[[4-(furan-2-ylmethyl)-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | CC1CCN(c2nnc(SCC(=O)NNC(=O)c3ccccc3)n2Cc2ccco2)CC1 |
| InChI | InChI=1S/C22H26N6O3S/c1-16-9-11-27(12-10-16)21-25-26-22(28(21)14-18-8-5-13-31-18)32-15-19(29)23-24-20(30)17-6-3-2-4-7-17/h2-8,13,16H,9-12,14-15H2,1H3,(H,23,29)(H,24,30) |
| InChIKey | KHLBUNRORHSEGM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|