C17H22N6O3S — CID 8838351
N'-[2-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 8838351) has the molecular formula C17H22N6O3S and a molecular weight of 390.47 g/mol. Its IUPAC name is N'-[2-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8838351 |
| Molecular Formula | C17H22N6O3S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N'-[2-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)c2ccccc2)nnc1N1CCOCC1 |
| InChI | InChI=1S/C17H22N6O3S/c1-2-23-16(22-8-10-26-11-9-22)20-21-17(23)27-12-14(24)18-19-15(25)13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3,(H,18,24)(H,19,25) |
| InChIKey | OKIVHTKVIUNOQB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|