C14H25N5O3S — CID 9378579
2-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-methoxypropyl)acetamide (PubChem CID 9378579) has the molecular formula C14H25N5O3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 9378579 |
| Molecular Formula | C14H25N5O3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-methoxypropyl)acetamide |
| SMILES | CCn1c(SCC(=O)NCCCOC)nnc1N1CCOCC1 |
| InChI | InChI=1S/C14H25N5O3S/c1-3-19-13(18-6-9-22-10-7-18)16-17-14(19)23-11-12(20)15-5-4-8-21-2/h3-11H2,1-2H3,(H,15,20) |
| InChIKey | ZAJHPLQJHSVYGX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|