C14H12BrN3O3S — CID 2437190
4-bromo-N'-[2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetyl]benzohydrazide (PubChem CID 2437190) has the molecular formula C14H12BrN3O3S and a molecular weight of 382.24 g/mol. Its IUPAC name is 4-bromo-N'-[2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 2437190 |
| Molecular Formula | C14H12BrN3O3S |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 4-bromo-N'-[2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetyl]benzohydrazide |
| SMILES | O=C(CSc1cccc[n+]1[O-])NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12BrN3O3S/c15-11-6-4-10(5-7-11)14(20)17-16-12(19)9-22-13-3-1-2-8-18(13)21/h1-8H,9H2,(H,16,19)(H,17,20) |
| InChIKey | CUMNISGWSRCNIY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 85.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|