C17H14BrClN2O4S — CID 30109513
[2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-chlorophenyl)sulfanylacetate (PubChem CID 30109513) has the molecular formula C17H14BrClN2O4S and a molecular weight of 457.73 g/mol. Its IUPAC name is [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-chlorophenyl)sulfanylacetate.
| Compound Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-chlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 30109513 |
| Molecular Formula | C17H14BrClN2O4S |
| Molecular Weight | 457.73 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-chlorophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccccc1Cl)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrClN2O4S/c18-12-7-5-11(6-8-12)17(24)21-20-15(22)9-25-16(23)10-26-14-4-2-1-3-13(14)19/h1-8H,9-10H2,(H,20,22)(H,21,24) |
| InChIKey | ZRBRDXIVVXRGQK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.73 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|