C23H19BrN2O4 — CID 2536174
[2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-phenylphenyl)acetate (PubChem CID 2536174) has the molecular formula C23H19BrN2O4 and a molecular weight of 467.32 g/mol. Its IUPAC name is [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-phenylphenyl)acetate.
| Compound Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 2536174 |
| Molecular Formula | C23H19BrN2O4 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(-c2ccccc2)cc1)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H19BrN2O4/c24-20-12-10-19(11-13-20)23(29)26-25-21(27)15-30-22(28)14-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-13H,14-15H2,(H,25,27)(H,26,29) |
| InChIKey | WEDCORQZJSSIHX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|