C12H10ClFN4O2S — CID 135458586
2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-chloro-4-fluorophenyl)acetamide (PubChem CID 135458586) has the molecular formula C12H10ClFN4O2S and a molecular weight of 328.76 g/mol. Its IUPAC name is 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-chloro-4-fluorophenyl)acetamide.
| Compound Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-chloro-4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 135458586 |
| Molecular Formula | C12H10ClFN4O2S |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-chloro-4-fluorophenyl)acetamide |
| SMILES | Nc1cc(=O)[nH]c(SCC(=O)Nc2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C12H10ClFN4O2S/c13-7-3-6(14)1-2-8(7)16-11(20)5-21-12-17-9(15)4-10(19)18-12/h1-4H,5H2,(H,16,20)(H3,15,17,18,19) |
| InChIKey | CWQWKRLPIIFHSZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |