C13H13FN4O2S — CID 135956095
N-(2-amino-5-fluorophenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 135956095) has the molecular formula C13H13FN4O2S and a molecular weight of 308.34 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135956095 |
| Molecular Formula | C13H13FN4O2S |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(=O)[nH]c(SCC(=O)Nc2cc(F)ccc2N)n1 |
| InChI | InChI=1S/C13H13FN4O2S/c1-7-4-11(19)18-13(16-7)21-6-12(20)17-10-5-8(14)2-3-9(10)15/h2-5H,6,15H2,1H3,(H,17,20)(H,16,18,19) |
| InChIKey | BIQUTUWUKIIZSD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|