C25H18N4O3S — CID 41425207
N-(9,10-dioxoanthracen-1-yl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 41425207) has the molecular formula C25H18N4O3S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 41425207 |
| Molecular Formula | C25H18N4O3S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccccc1-n1cnnc1SCC(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H18N4O3S/c1-15-7-2-5-12-20(15)29-14-26-28-25(29)33-13-21(30)27-19-11-6-10-18-22(19)24(32)17-9-4-3-8-16(17)23(18)31/h2-12,14H,13H2,1H3,(H,27,30) |
| InChIKey | XBPSQMAGZXXIIM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|