C32H24N4O3S — CID 4060216
2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 4060216) has the molecular formula C32H24N4O3S and a molecular weight of 544.64 g/mol. Its IUPAC name is 2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 4060216 |
| Molecular Formula | C32H24N4O3S |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)nnc2-c2ccccc2)cc1C |
| InChI | InChI=1S/C32H24N4O3S/c1-19-15-16-22(17-20(19)2)36-31(21-9-4-3-5-10-21)34-35-32(36)40-18-27(37)33-26-14-8-13-25-28(26)30(39)24-12-7-6-11-23(24)29(25)38/h3-17H,18H2,1-2H3,(H,33,37) |
| InChIKey | IEYPPACRVGHJRP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|