C20H21N5O2S — CID 8870588
N'-acetyl-2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide (PubChem CID 8870588) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is N'-acetyl-2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide.
| Compound Name | N'-acetyl-2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 8870588 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N'-acetyl-2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1nnc(-c2ccccc2)n1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H21N5O2S/c1-13-9-10-17(11-14(13)2)25-19(16-7-5-4-6-8-16)23-24-20(25)28-12-18(27)22-21-15(3)26/h4-11H,12H2,1-3H3,(H,21,26)(H,22,27) |
| InChIKey | OVJQTTYOBUURRR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|