C22H21N5OS — CID 5008612
3-amino-2-[2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]but-2-enenitrile (PubChem CID 5008612) has the molecular formula C22H21N5OS and a molecular weight of 403.51 g/mol. Its IUPAC name is 3-amino-2-[2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]but-2-enenitrile.
| Compound Name | 3-amino-2-[2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]but-2-enenitrile |
|---|---|
| PubChem CID | 5008612 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-amino-2-[2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]but-2-enenitrile |
| SMILES | CC(N)=C(C#N)C(=O)CSc1nnc(-c2ccccc2)n1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H21N5OS/c1-14-9-10-18(11-15(14)2)27-21(17-7-5-4-6-8-17)25-26-22(27)29-13-20(28)19(12-23)16(3)24/h4-11H,13,24H2,1-3H3 |
| InChIKey | DUMZURVEDPGPMQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|