C18H17IN4OS — CID 112778108
N-(4-iodo-2-methylphenyl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 112778108) has the molecular formula C18H17IN4OS and a molecular weight of 464.33 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 112778108 |
| Molecular Formula | C18H17IN4OS |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CSc1nncn1-c1ccccc1C |
| InChI | InChI=1S/C18H17IN4OS/c1-12-5-3-4-6-16(12)23-11-20-22-18(23)25-10-17(24)21-15-8-7-14(19)9-13(15)2/h3-9,11H,10H2,1-2H3,(H,21,24) |
| InChIKey | ZCEKWEZWYXSOSY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|