C15H21N3O3S — CID 24681455
2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-N-(3-methoxypropyl)acetamide (PubChem CID 24681455) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 24681455 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-N-(3-methoxypropyl)acetamide |
| SMILES | CCOc1ccc2nc(SCC(=O)NCCCOC)[nH]c2c1 |
| InChI | InChI=1S/C15H21N3O3S/c1-3-21-11-5-6-12-13(9-11)18-15(17-12)22-10-14(19)16-7-4-8-20-2/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | XRIHSLVZLRPUMF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|