C16H16N4O3S2 — CID 5134152
N'-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 5134152) has the molecular formula C16H16N4O3S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N'-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 5134152 |
| Molecular Formula | C16H16N4O3S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N'-[2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | CCOc1ccc2nc(SCC(=O)NNC(=O)c3cccs3)[nH]c2c1 |
| InChI | InChI=1S/C16H16N4O3S2/c1-2-23-10-5-6-11-12(8-10)18-16(17-11)25-9-14(21)19-20-15(22)13-4-3-7-24-13/h3-8H,2,9H2,1H3,(H,17,18)(H,19,21)(H,20,22) |
| InChIKey | ULODVIYKILKSES-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|