C17H15ClN4O3S — CID 7152421
4-chloro-N'-[2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 7152421) has the molecular formula C17H15ClN4O3S and a molecular weight of 390.85 g/mol. Its IUPAC name is 4-chloro-N'-[2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7152421 |
| Molecular Formula | C17H15ClN4O3S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 4-chloro-N'-[2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | COc1ccc2nc(SCC(=O)NNC(=O)c3ccc(Cl)cc3)[nH]c2c1 |
| InChI | InChI=1S/C17H15ClN4O3S/c1-25-12-6-7-13-14(8-12)20-17(19-13)26-9-15(23)21-22-16(24)10-2-4-11(18)5-3-10/h2-8H,9H2,1H3,(H,19,20)(H,21,23)(H,22,24) |
| InChIKey | GFENKDNOXMLITN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|