C16H11ClF2N4O2S — CID 34375476
4-chloro-N'-[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 34375476) has the molecular formula C16H11ClF2N4O2S and a molecular weight of 396.81 g/mol. Its IUPAC name is 4-chloro-N'-[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 34375476 |
| Molecular Formula | C16H11ClF2N4O2S |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 4-chloro-N'-[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1nc2cc(F)c(F)cc2[nH]1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClF2N4O2S/c17-9-3-1-8(2-4-9)15(25)23-22-14(24)7-26-16-20-12-5-10(18)11(19)6-13(12)21-16/h1-6H,7H2,(H,20,21)(H,22,24)(H,23,25) |
| InChIKey | PYZXIVQWWRASML-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|