C18H14ClFN4O2S — CID 46825614
4-chloro-N'-[2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 46825614) has the molecular formula C18H14ClFN4O2S and a molecular weight of 404.85 g/mol. Its IUPAC name is 4-chloro-N'-[2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 46825614 |
| Molecular Formula | C18H14ClFN4O2S |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 4-chloro-N'-[2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1ncc(-c2ccc(F)cc2)[nH]1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClFN4O2S/c19-13-5-1-12(2-6-13)17(26)24-23-16(25)10-27-18-21-9-15(22-18)11-3-7-14(20)8-4-11/h1-9H,10H2,(H,21,22)(H,23,25)(H,24,26) |
| InChIKey | WWRXKCSWGOVDNO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|