C19H22N10O2S2 — CID 21026812
2-(7H-purin-6-ylsulfanyl)-N-[5-[[2-(7H-purin-6-ylsulfanyl)acetyl]amino]pentyl]acetamide (PubChem CID 21026812) has the molecular formula C19H22N10O2S2 and a molecular weight of 486.59 g/mol. Its IUPAC name is 2-(7H-purin-6-ylsulfanyl)-N-[5-[[2-(7H-purin-6-ylsulfanyl)acetyl]amino]pentyl]acetamide.
| Compound Name | 2-(7H-purin-6-ylsulfanyl)-N-[5-[[2-(7H-purin-6-ylsulfanyl)acetyl]amino]pentyl]acetamide |
|---|---|
| PubChem CID | 21026812 |
| Molecular Formula | C19H22N10O2S2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-(7H-purin-6-ylsulfanyl)-N-[5-[[2-(7H-purin-6-ylsulfanyl)acetyl]amino]pentyl]acetamide |
| SMILES | O=C(CSc1ncnc2nc[nH]c12)NCCCCCNC(=O)CSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C19H22N10O2S2/c30-12(6-32-18-14-16(24-8-22-14)26-10-28-18)20-4-2-1-3-5-21-13(31)7-33-19-15-17(25-9-23-15)27-11-29-19/h8-11H,1-7H2,(H,20,30)(H,21,31)(H,22,24,26,28)(H,23,25,27,29) |
| InChIKey | LOHUOBSBWKAHNS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 167.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|