C12H9ClN6OS — CID 23101849
N-(2-chloro-3-pyridinyl)-2-(7H-purin-6-ylsulfanyl)acetamide (PubChem CID 23101849) has the molecular formula C12H9ClN6OS and a molecular weight of 320.77 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-(7H-purin-6-ylsulfanyl)acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-(7H-purin-6-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 23101849 |
| Molecular Formula | C12H9ClN6OS |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-(7H-purin-6-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1ncnc2nc[nH]c12)Nc1cccnc1Cl |
| InChI | InChI=1S/C12H9ClN6OS/c13-10-7(2-1-3-14-10)19-8(20)4-21-12-9-11(16-5-15-9)17-6-18-12/h1-3,5-6H,4H2,(H,19,20)(H,15,16,17,18) |
| InChIKey | CHIRGHGDQIWIHV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|