C15H15N5OS — CID 726078
N-[(1S)-1-phenylethyl]-2-(7H-purin-6-ylsulfanyl)acetamide (PubChem CID 726078) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-2-(7H-purin-6-ylsulfanyl)acetamide.
| Compound Name | N-[(1S)-1-phenylethyl]-2-(7H-purin-6-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 726078 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-2-(7H-purin-6-ylsulfanyl)acetamide |
| SMILES | C[C@H](NC(=O)CSc1ncnc2nc[nH]c12)c1ccccc1 |
| InChI | InChI=1S/C15H15N5OS/c1-10(11-5-3-2-4-6-11)20-12(21)7-22-15-13-14(17-8-16-13)18-9-19-15/h2-6,8-10H,7H2,1H3,(H,20,21)(H,16,17,18,19)/t10-/m0/s1 |
| InChIKey | OOBCBPUOTRXKQW-JTQLQIEISA-N |
| XLogP | 2.32 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |