C20H19N3OS2 — CID 92897230
N-[(1S)-1-phenylethyl]-2-(3-phenylsulfanylpyrazin-2-yl)sulfanylacetamide (PubChem CID 92897230) has the molecular formula C20H19N3OS2 and a molecular weight of 381.53 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-2-(3-phenylsulfanylpyrazin-2-yl)sulfanylacetamide.
| Compound Name | N-[(1S)-1-phenylethyl]-2-(3-phenylsulfanylpyrazin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 92897230 |
| Molecular Formula | C20H19N3OS2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-2-(3-phenylsulfanylpyrazin-2-yl)sulfanylacetamide |
| SMILES | C[C@H](NC(=O)CSc1nccnc1Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19N3OS2/c1-15(16-8-4-2-5-9-16)23-18(24)14-25-19-20(22-13-12-21-19)26-17-10-6-3-7-11-17/h2-13,15H,14H2,1H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | XWFRYPDRDQGKAI-HNNXBMFYSA-N |
| XLogP | 4.60 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |