C22H23N3O2S2 — CID 50836290
N-[1-(4-methoxyphenyl)ethyl]-2-[3-(2-methylphenyl)sulfanylpyrazin-2-yl]sulfanylacetamide (PubChem CID 50836290) has the molecular formula C22H23N3O2S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)ethyl]-2-[3-(2-methylphenyl)sulfanylpyrazin-2-yl]sulfanylacetamide.
| Compound Name | N-[1-(4-methoxyphenyl)ethyl]-2-[3-(2-methylphenyl)sulfanylpyrazin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 50836290 |
| Molecular Formula | C22H23N3O2S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[1-(4-methoxyphenyl)ethyl]-2-[3-(2-methylphenyl)sulfanylpyrazin-2-yl]sulfanylacetamide |
| SMILES | COc1ccc(C(C)NC(=O)CSc2nccnc2Sc2ccccc2C)cc1 |
| InChI | InChI=1S/C22H23N3O2S2/c1-15-6-4-5-7-19(15)29-22-21(23-12-13-24-22)28-14-20(26)25-16(2)17-8-10-18(27-3)11-9-17/h4-13,16H,14H2,1-3H3,(H,25,26) |
| InChIKey | ADWBJVHUHDNMFH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |