C12H11N5O2S — CID 3701880
N-(furan-2-ylmethyl)-2-(7H-purin-6-ylsulfanyl)acetamide (PubChem CID 3701880) has the molecular formula C12H11N5O2S and a molecular weight of 289.32 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(7H-purin-6-ylsulfanyl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(7H-purin-6-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 3701880 |
| Molecular Formula | C12H11N5O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(7H-purin-6-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1ncnc2nc[nH]c12)NCc1ccco1 |
| InChI | InChI=1S/C12H11N5O2S/c18-9(13-4-8-2-1-3-19-8)5-20-12-10-11(15-6-14-10)16-7-17-12/h1-3,6-7H,4-5H2,(H,13,18)(H,14,15,16,17) |
| InChIKey | NIDJWAOBHTUPNU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |