C15H16N6O2 — CID 99636793
(2R)-N-(furan-2-ylmethyl)-1-(7H-purin-6-yl)pyrrolidine-2-carboxamide (PubChem CID 99636793) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is (2R)-N-(furan-2-ylmethyl)-1-(7H-purin-6-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(furan-2-ylmethyl)-1-(7H-purin-6-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 99636793 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (2R)-N-(furan-2-ylmethyl)-1-(7H-purin-6-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccco1)[C@H]1CCCN1c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C15H16N6O2/c22-15(16-7-10-3-2-6-23-10)11-4-1-5-21(11)14-12-13(18-8-17-12)19-9-20-14/h2-3,6,8-9,11H,1,4-5,7H2,(H,16,22)(H,17,18,19,20)/t11-/m1/s1 |
| InChIKey | UFXMQHADIBIAII-LLVKDONJSA-N |
| XLogP | 1.23 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |