C15H15F3N4O2 — CID 32877863
(2S)-N-(furan-2-ylmethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidine-2-carboxamide (PubChem CID 32877863) has the molecular formula C15H15F3N4O2 and a molecular weight of 340.31 g/mol. Its IUPAC name is (2S)-N-(furan-2-ylmethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(furan-2-ylmethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 32877863 |
| Molecular Formula | C15H15F3N4O2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (2S)-N-(furan-2-ylmethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccco1)[C@@H]1CCCN1c1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H15F3N4O2/c16-15(17,18)12-5-6-19-14(21-12)22-7-1-4-11(22)13(23)20-9-10-3-2-8-24-10/h2-3,5-6,8,11H,1,4,7,9H2,(H,20,23)/t11-/m0/s1 |
| InChIKey | UVCDFRGRSZPLJD-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |