C15H13F4N3O2 — CID 91644166
N-(furan-2-ylmethyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrrolidine-2-carboxamide (PubChem CID 91644166) has the molecular formula C15H13F4N3O2 and a molecular weight of 343.28 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91644166 |
| Molecular Formula | C15H13F4N3O2 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccco1)C1CCCN1c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C15H13F4N3O2/c16-10-12(11(17)14(19)21-13(10)18)22-5-1-4-9(22)15(23)20-7-8-3-2-6-24-8/h2-3,6,9H,1,4-5,7H2,(H,20,23) |
| InChIKey | GVJDRAJPOKQUKN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|